Organic metalloid salts
Chem-Impex International, Inc. Triisopropyl borate | MFCD00008872 | 25G
Triisopropyl borate, MFCD00008872, 25G
Chem-Impex International, Inc. Tributyl borate | MFCD00009434 | 250ML
Tributyl borate, MFCD00009434, 250ML
(C)CCO | 5g | 773165539](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000158657.jpg-250.jpg)
eMolecules 2916-68-9 | 2-(Trimethylsilyl)ethanol | Ochem Incorporation | MFCD00002825 | 118.251 | C5H14OSi | 98.000 | C[Si](C)(C)CCO | 5g | 773165539
2-(Trimethylsilyl)ethanol | Ochem Incorporation | 2916-68-9 | MFCD00002825 | 118.251 | C5H14OSi | 98.000 | C[Si](C)(C)CCO | 5g | 773165539
(F)F.CC[N+](CC)(CC)CC | 25g | 562456007](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000163785.jpg-250.jpg)
eMolecules 429-06-1 | Tetraethylammonium tetrafluoroborate | Apollo Scientific | MFCD00011827 | 217.060 | C8H20BF4N | 97.000 | F[B-](F)(F)F.CC[N+](CC)(CC)CC | 25g | 562456007
Tetraethylammonium tetrafluoroborate | Apollo Scientific | 429-06-1 | MFCD00011827 | 217.060 | C8H20BF4N | 97.000 | F[B-](F)(F)F.CC[N+](CC)(CC)CC | 25g | 562456007
eMolecules 58943-98-9 | Hexakis(2,2,3,3-tetrafluoropropoxy)phosphazene | Apollo Scientific | MFCD00798140 | 921.240 | C18H18F24N3O6P3 | 95.000 | FC(F)C(F)(F)COP1(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=N1 | 250mg | 562428361
Hexakis(2,2,3,3-tetrafluoropropoxy)phosphazene | Apollo Scientific | 58943-98-9 | MFCD00798140 | 921.240 | C18H18F24N3O6P3 | 95.000 | FC(F)C(F)(F)COP1(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=N1 | 250mg | 562428361
eMolecules 2916-68-9 | 2-(Trimethylsilyl)ethanol | Ochem Incorporation | MFCD00002825 | 118.251 | C5H14OSi | 98.000 | C[Si](C)(C)CCO | 25g | 773165540
2-(Trimethylsilyl)ethanol | Ochem Incorporation | 2916-68-9 | MFCD00002825 | 118.251 | C5H14OSi | 98.000 | C[Si](C)(C)CCO | 25g | 773165540
(C)CCO | 5g | 480171180](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000165688.jpg-250.jpg)
eMolecules 2916-68-9 | 2-Trimethylsilylethanol | Oakwood Chemicals | MFCD00002825 | 118.251 | C5H14OSi | 95.000 | C[Si](C)(C)CCO | 5g | 480171180
2-Trimethylsilylethanol | Oakwood Chemicals | 2916-68-9 | MFCD00002825 | 118.251 | C5H14OSi | 95.000 | C[Si](C)(C)CCO | 5g | 480171180
eMolecules 103614-40-0 | (S)-tert-Butyl 2-(methylamino)propanoate hydrochloride | MFCD08457605 | 1g
Pharmablock | tert-butyl 5-amino-4-(benzyloxycarbonylamino)-5-oxo-pentanoate | 25mg | 761744617 | PBLH504 | 106571-82-8 | 336.388 | C17H24N2O5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 420-37-1 | Trimethyloxonium tetrafluoroborate | Oakwood Chemical | MFCD00011798 | 147.910 | C3H9BF4O | 95.000 | C[O+](C)C.F[B-](F)(F)F | 500g | 553411177
Trimethyloxonium tetrafluoroborate | Oakwood Chemical | 420-37-1 | MFCD00011798 | 147.910 | C3H9BF4O | 95.000 | C[O+](C)C.F[B-](F)(F)F | 500g | 553411177
Cayman Chemical L902 688 Prostaglandins
A potent and selective agonist of the human PGE2 receptor, EP4 with a Ki value of 0.38 nM and an EC50 value of 0.6 nM; induces thermal hyperalgesia when injected into guinea pig forepaw and increases vasodilation of human pulmonary vein